C12H14N4O3 — CID 136559619
1-(1H-imidazol-5-yl)-2-(3-methyl-4-nitroanilino)ethanol (PubChem CID 136559619) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-2-(3-methyl-4-nitroanilino)ethanol.
| Compound Name | 1-(1H-imidazol-5-yl)-2-(3-methyl-4-nitroanilino)ethanol |
|---|---|
| PubChem CID | 136559619 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-2-(3-methyl-4-nitroanilino)ethanol |
| SMILES | Cc1cc(NCC(O)c2cnc[nH]2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O3/c1-8-4-9(2-3-11(8)16(18)19)14-6-12(17)10-5-13-7-15-10/h2-5,7,12,14,17H,6H2,1H3,(H,13,15) |
| InChIKey | ZYZIMPYCCKZOFJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|