C10H10F2N2O4 — CID 55086404
3-(2,3-difluoro-6-nitroanilino)butanoic acid (PubChem CID 55086404) has the molecular formula C10H10F2N2O4 and a molecular weight of 260.20 g/mol. Its IUPAC name is 3-(2,3-difluoro-6-nitroanilino)butanoic acid.
| Compound Name | 3-(2,3-difluoro-6-nitroanilino)butanoic acid |
|---|---|
| PubChem CID | 55086404 |
| Molecular Formula | C10H10F2N2O4 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-(2,3-difluoro-6-nitroanilino)butanoic acid |
| SMILES | CC(CC(=O)O)Nc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C10H10F2N2O4/c1-5(4-8(15)16)13-10-7(14(17)18)3-2-6(11)9(10)12/h2-3,5,13H,4H2,1H3,(H,15,16) |
| InChIKey | CEGKOUWRIGOBPP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|