C13H16N2O4 — CID 175187189
(3S)-3-[(7-nitro-2,3-dihydro-1H-inden-4-yl)amino]butanoic acid (PubChem CID 175187189) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3S)-3-[(7-nitro-2,3-dihydro-1H-inden-4-yl)amino]butanoic acid.
| Compound Name | (3S)-3-[(7-nitro-2,3-dihydro-1H-inden-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 175187189 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (3S)-3-[(7-nitro-2,3-dihydro-1H-inden-4-yl)amino]butanoic acid |
| SMILES | C[C@@H](CC(=O)O)Nc1ccc([N+](=O)[O-])c2c1CCC2 |
| InChI | InChI=1S/C13H16N2O4/c1-8(7-13(16)17)14-11-5-6-12(15(18)19)10-4-2-3-9(10)11/h5-6,8,14H,2-4,7H2,1H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | URMNSOMHBMDETA-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|