C11H14F2N2O3 — CID 62531449
2,3-difluoro-N-(3-methoxy-2-methylpropyl)-6-nitroaniline (PubChem CID 62531449) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is 2,3-difluoro-N-(3-methoxy-2-methylpropyl)-6-nitroaniline.
| Compound Name | 2,3-difluoro-N-(3-methoxy-2-methylpropyl)-6-nitroaniline |
|---|---|
| PubChem CID | 62531449 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2,3-difluoro-N-(3-methoxy-2-methylpropyl)-6-nitroaniline |
| SMILES | COCC(C)CNc1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C11H14F2N2O3/c1-7(6-18-2)5-14-11-9(15(16)17)4-3-8(12)10(11)13/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | VCFAOIGLJCQURY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|