C26H26N4O3 — CID 11590337
2-(2,2-dimethylchromen-6-yl)-1-(3,5-dimethylphenyl)-1-(4-nitrophenyl)guanidine (PubChem CID 11590337) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(2,2-dimethylchromen-6-yl)-1-(3,5-dimethylphenyl)-1-(4-nitrophenyl)guanidine.
| Compound Name | 2-(2,2-dimethylchromen-6-yl)-1-(3,5-dimethylphenyl)-1-(4-nitrophenyl)guanidine |
|---|---|
| PubChem CID | 11590337 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-(2,2-dimethylchromen-6-yl)-1-(3,5-dimethylphenyl)-1-(4-nitrophenyl)guanidine |
| SMILES | Cc1cc(C)cc(N(/C(N)=N/c2ccc3c(c2)C=CC(C)(C)O3)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C26H26N4O3/c1-17-13-18(2)15-23(14-17)29(21-6-8-22(9-7-21)30(31)32)25(27)28-20-5-10-24-19(16-20)11-12-26(3,4)33-24/h5-16H,1-4H3,(H2,27,28) |
| InChIKey | UYPPXBILDGSMHE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|