C20H18N6O4 — CID 19882427
1-cyano-1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-(4-nitrophenyl)guanidine (PubChem CID 19882427) has the molecular formula C20H18N6O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is 1-cyano-1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-(4-nitrophenyl)guanidine.
| Compound Name | 1-cyano-1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-(4-nitrophenyl)guanidine |
|---|---|
| PubChem CID | 19882427 |
| Molecular Formula | C20H18N6O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-cyano-1-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-2-(4-nitrophenyl)guanidine |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(N(C#N)/C(N)=N/c2ccc([N+](=O)[O-])cc2)C1O |
| InChI | InChI=1S/C20H18N6O4/c1-20(2)18(27)17(15-9-12(10-21)3-8-16(15)30-20)25(11-22)19(23)24-13-4-6-14(7-5-13)26(28)29/h3-9,17-18,27H,1-2H3,(H2,23,24) |
| InChIKey | NFLAWHKOBVIKKD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|