C22H22N4O6 — CID 67869531
ethyl N-[N-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-C-(4-nitrophenyl)carbonimidoyl]carbamate (PubChem CID 67869531) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is ethyl N-[N-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-C-(4-nitrophenyl)carbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-C-(4-nitrophenyl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 67869531 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | ethyl N-[N-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-C-(4-nitrophenyl)carbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N\[C@@H]1c2cc(C#N)ccc2OC(C)(C)[C@H]1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N4O6/c1-4-31-21(28)25-20(14-6-8-15(9-7-14)26(29)30)24-18-16-11-13(12-23)5-10-17(16)32-22(2,3)19(18)27/h5-11,18-19,27H,4H2,1-3H3,(H,24,25,28)/t18-,19+/m1/s1 |
| InChIKey | ZXTNVGBFTSZDJR-MOPGFXCFSA-N |
| XLogP | 3.23 |
| TPSA | 147.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|