C18H14N2O3 — CID 141087850
3',4'-dimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 141087850) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3',4'-dimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 3',4'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 141087850 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3',4'-dimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CC1=c2c(C)cccc2=NC12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C18H14N2O3/c1-11-4-3-5-15-17(11)12(2)18(19-15)9-8-13-10-14(20(21)22)6-7-16(13)23-18/h3-10H,1-2H3 |
| InChIKey | QPAXKZWZQDIRLV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|