C29H24N4O3 — CID 168865436
1',3',3'-trimethyl-6-nitro-4',7'-dipyridin-4-ylspiro[chromene-2,2'-indole] (PubChem CID 168865436) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1',3',3'-trimethyl-6-nitro-4',7'-dipyridin-4-ylspiro[chromene-2,2'-indole].
| Compound Name | 1',3',3'-trimethyl-6-nitro-4',7'-dipyridin-4-ylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 168865436 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1',3',3'-trimethyl-6-nitro-4',7'-dipyridin-4-ylspiro[chromene-2,2'-indole] |
| SMILES | CN1c2c(-c3ccncc3)ccc(-c3ccncc3)c2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C29H24N4O3/c1-28(2)26-23(19-9-14-30-15-10-19)5-6-24(20-11-16-31-17-12-20)27(26)32(3)29(28)13-8-21-18-22(33(34)35)4-7-25(21)36-29/h4-18H,1-3H3 |
| InChIKey | MWUCWCBPLHPGIM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|