C17H14N2O3Se — CID 14716574
3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene] (PubChem CID 14716574) has the molecular formula C17H14N2O3Se and a molecular weight of 373.27 g/mol. Its IUPAC name is 3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene].
| Compound Name | 3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene] |
|---|---|
| PubChem CID | 14716574 |
| Molecular Formula | C17H14N2O3Se |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 3,5-dimethyl-6'-nitrospiro[1,3-benzoselenazole-2,2'-chromene] |
| SMILES | Cc1ccc2c(c1)N(C)C1(C=Cc3cc([N+](=O)[O-])ccc3O1)[Se]2 |
| InChI | InChI=1S/C17H14N2O3Se/c1-11-3-6-16-14(9-11)18(2)17(23-16)8-7-12-10-13(19(20)21)4-5-15(12)22-17/h3-10H,1-2H3 |
| InChIKey | JAJIRTRGKSRTQT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|