C11H7N5O4 — CID 56695479
2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)hydrazinylidene]propanedinitrile (PubChem CID 56695479) has the molecular formula C11H7N5O4 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 56695479 |
| Molecular Formula | C11H7N5O4 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-[(6-nitro-2,3-dihydro-1,4-benzodioxin-7-yl)hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C11H7N5O4/c12-5-7(6-13)14-15-8-3-10-11(20-2-1-19-10)4-9(8)16(17)18/h3-4,15H,1-2H2 |
| InChIKey | GPJCINNAICLKFZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|