C8H7N5O5 — CID 169326184
2-(2-azido-4,6-dinitrophenyl)ethanol (PubChem CID 169326184) has the molecular formula C8H7N5O5 and a molecular weight of 253.17 g/mol. Its IUPAC name is 2-(2-azido-4,6-dinitrophenyl)ethanol.
| Compound Name | 2-(2-azido-4,6-dinitrophenyl)ethanol |
|---|---|
| PubChem CID | 169326184 |
| Molecular Formula | C8H7N5O5 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-(2-azido-4,6-dinitrophenyl)ethanol |
| SMILES | [N-]=[N+]=Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1CCO |
| InChI | InChI=1S/C8H7N5O5/c9-11-10-7-3-5(12(15)16)4-8(13(17)18)6(7)1-2-14/h3-4,14H,1-2H2 |
| InChIKey | JCBNTXMHSURTPB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|