C13H12N8O4 — CID 11450762
1-(2-azido-4,6-dinitrophenyl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine (PubChem CID 11450762) has the molecular formula C13H12N8O4 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-(2-azido-4,6-dinitrophenyl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine.
| Compound Name | 1-(2-azido-4,6-dinitrophenyl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine |
|---|---|
| PubChem CID | 11450762 |
| Molecular Formula | C13H12N8O4 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-(2-azido-4,6-dinitrophenyl)-N-(1,3,5-trimethylpyrazol-4-yl)methanimine |
| SMILES | Cc1nn(C)c(C)c1/N=C/c1c(N=[N+]=[N-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N8O4/c1-7-13(8(2)19(3)17-7)15-6-10-11(16-18-14)4-9(20(22)23)5-12(10)21(24)25/h4-6H,1-3H3/b15-6+ |
| InChIKey | JLKWMLNMJHSDCU-GIDUJCDVSA-N |
| XLogP | 3.55 |
| TPSA | 165.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|