C11H6BrN3O2 — CID 168541783
2-bromo-3-(2,2-dicyanoethenylamino)benzoic acid (PubChem CID 168541783) has the molecular formula C11H6BrN3O2 and a molecular weight of 292.09 g/mol. Its IUPAC name is 2-bromo-3-(2,2-dicyanoethenylamino)benzoic acid.
| Compound Name | 2-bromo-3-(2,2-dicyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168541783 |
| Molecular Formula | C11H6BrN3O2 |
| Molecular Weight | 292.09 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | 2-bromo-3-(2,2-dicyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=CNc1cccc(C(=O)O)c1Br |
| InChI | InChI=1S/C11H6BrN3O2/c12-10-8(11(16)17)2-1-3-9(10)15-6-7(4-13)5-14/h1-3,6,15H,(H,16,17) |
| InChIKey | FJAANFYANWHELP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.09 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|