C12H8IN3O3 — CID 168543006
4-(2,2-dicyanoethenylamino)-5-iodo-2-methoxybenzoic acid (PubChem CID 168543006) has the molecular formula C12H8IN3O3 and a molecular weight of 369.12 g/mol. Its IUPAC name is 4-(2,2-dicyanoethenylamino)-5-iodo-2-methoxybenzoic acid.
| Compound Name | 4-(2,2-dicyanoethenylamino)-5-iodo-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 168543006 |
| Molecular Formula | C12H8IN3O3 |
| Molecular Weight | 369.12 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 4-(2,2-dicyanoethenylamino)-5-iodo-2-methoxybenzoic acid |
| SMILES | COc1cc(NC=C(C#N)C#N)c(I)cc1C(=O)O |
| InChI | InChI=1S/C12H8IN3O3/c1-19-11-3-10(16-6-7(4-14)5-15)9(13)2-8(11)12(17)18/h2-3,6,16H,1H3,(H,17,18) |
| InChIKey | BEDIFMYKKJCQQX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|