C13H10ClN3O3 — CID 168542745
methyl 4-chloro-3-(2,2-dicyanoethenylamino)-5-methoxybenzoate (PubChem CID 168542745) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is methyl 4-chloro-3-(2,2-dicyanoethenylamino)-5-methoxybenzoate.
| Compound Name | methyl 4-chloro-3-(2,2-dicyanoethenylamino)-5-methoxybenzoate |
|---|---|
| PubChem CID | 168542745 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | methyl 4-chloro-3-(2,2-dicyanoethenylamino)-5-methoxybenzoate |
| SMILES | COC(=O)c1cc(NC=C(C#N)C#N)c(Cl)c(OC)c1 |
| InChI | InChI=1S/C13H10ClN3O3/c1-19-11-4-9(13(18)20-2)3-10(12(11)14)17-7-8(5-15)6-16/h3-4,7,17H,1-2H3 |
| InChIKey | YMMNPTGDGMKLDE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|