C18H11N3O4 — CID 168543865
methyl 4-(2,2-dicyanoethenylamino)dibenzo-p-dioxin-2-carboxylate (PubChem CID 168543865) has the molecular formula C18H11N3O4 and a molecular weight of 333.30 g/mol. Its IUPAC name is methyl 4-(2,2-dicyanoethenylamino)dibenzo-p-dioxin-2-carboxylate.
| Compound Name | methyl 4-(2,2-dicyanoethenylamino)dibenzo-p-dioxin-2-carboxylate |
|---|---|
| PubChem CID | 168543865 |
| Molecular Formula | C18H11N3O4 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | methyl 4-(2,2-dicyanoethenylamino)dibenzo-p-dioxin-2-carboxylate |
| SMILES | COC(=O)c1cc(NC=C(C#N)C#N)c2c(c1)Oc1ccccc1O2 |
| InChI | InChI=1S/C18H11N3O4/c1-23-18(22)12-6-13(21-10-11(8-19)9-20)17-16(7-12)24-14-4-2-3-5-15(14)25-17/h2-7,10,21H,1H3 |
| InChIKey | NOIJZZBMUDDOGX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|