methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate

C13H11N3O2 — CID 168541208

IUPACmethyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate
SMILESCOC(=O)c1cc(C)ccc1NC=C(C#N)C#N
InChIInChI=1S/C13H11N3O2/c1-9-3-4-12(11(5-9)13(17)18-2)16-8-10(6-14)7-15/h3-5,8,16H,1-2H3
InChIKeyOYORCMLMXAJIRT-UHFFFAOYSA-N
MW241.25 g/mol
LogP2.12
Rot. Bonds3

About methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate

methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate (PubChem CID 168541208) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate.

Molecular Properties

Compound Namemethyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate
PubChem CID168541208
Molecular FormulaC13H11N3O2
Molecular Weight241.25 g/mol
Exact Mass241.09
IUPAC Namemethyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate
SMILESCOC(=O)c1cc(C)ccc1NC=C(C#N)C#N
InChIInChI=1S/C13H11N3O2/c1-9-3-4-12(11(5-9)13(17)18-2)16-8-10(6-14)7-15/h3-5,8,16H,1-2H3
InChIKeyOYORCMLMXAJIRT-UHFFFAOYSA-N
XLogP2.12
TPSA85.91 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}

Analyze methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate?
The IUPAC name of methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate (CID 168541208) is methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate.
What is the SMILES notation for methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate?
The canonical SMILES for methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate is COC(=O)c1cc(C)ccc1NC=C(C#N)C#N.
What is the InChIKey of methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate?
The InChIKey is OYORCMLMXAJIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2/c1-9-3-4-12(11(5-9)13(17)18-2)16-8-10(6-14)7-15/h3-5,8,16H,1-2H3.
What are the key properties of methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate?
methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate has a molecular weight of 241.25 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate is sourced from PubChem (CID 168541208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).