C13H11N3O2 — CID 168541208
methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate (PubChem CID 168541208) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate.
| Compound Name | methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate |
|---|---|
| PubChem CID | 168541208 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | methyl 2-(2,2-dicyanoethenylamino)-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1NC=C(C#N)C#N |
| InChI | InChI=1S/C13H11N3O2/c1-9-3-4-12(11(5-9)13(17)18-2)16-8-10(6-14)7-15/h3-5,8,16H,1-2H3 |
| InChIKey | OYORCMLMXAJIRT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|