C14H10N4O3 — CID 168545389
methyl 7-(2,2-dicyanoethenylamino)-2-methyl-1,3-benzoxazole-5-carboxylate (PubChem CID 168545389) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 7-(2,2-dicyanoethenylamino)-2-methyl-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 7-(2,2-dicyanoethenylamino)-2-methyl-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 168545389 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | methyl 7-(2,2-dicyanoethenylamino)-2-methyl-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC=C(C#N)C#N)c2oc(C)nc2c1 |
| InChI | InChI=1S/C14H10N4O3/c1-8-18-12-4-10(14(19)20-2)3-11(13(12)21-8)17-7-9(5-15)6-16/h3-4,7,17H,1-2H3 |
| InChIKey | DBEBQBFPNJXDCP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|