methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate

C17H14N2O4 — CID 168651364

IUPACmethyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate
SMILESCOC(=O)c1cc(NC=O)c2oc(Cc3ccccc3)nc2c1
InChIInChI=1S/C17H14N2O4/c1-22-17(21)12-8-13(18-10-20)16-14(9-12)19-15(23-16)7-11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3,(H,18,20)
InChIKeyYCUJAQRMWBOTED-UHFFFAOYSA-N
MW310.31 g/mol
LogP2.77
Rot. Bonds5

About methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate

methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate (PubChem CID 168651364) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate
PubChem CID168651364
Molecular FormulaC17H14N2O4
Molecular Weight310.31 g/mol
Exact Mass310.10
IUPAC Namemethyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate
SMILESCOC(=O)c1cc(NC=O)c2oc(Cc3ccccc3)nc2c1
InChIInChI=1S/C17H14N2O4/c1-22-17(21)12-8-13(18-10-20)16-14(9-12)19-15(23-16)7-11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3,(H,18,20)
InChIKeyYCUJAQRMWBOTED-UHFFFAOYSA-N
XLogP2.77
TPSA81.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.31
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate?
The IUPAC name of methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate (CID 168651364) is methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate.
What is the SMILES notation for methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate?
The canonical SMILES for methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate is COC(=O)c1cc(NC=O)c2oc(Cc3ccccc3)nc2c1.
What is the InChIKey of methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate?
The InChIKey is YCUJAQRMWBOTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4/c1-22-17(21)12-8-13(18-10-20)16-14(9-12)19-15(23-16)7-11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3,(H,18,20).
What are the key properties of methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate?
methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate has a molecular weight of 310.31 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate is sourced from PubChem (CID 168651364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).