C17H14N2O4 — CID 168651364
methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate (PubChem CID 168651364) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 168651364 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 2-benzyl-7-formamido-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC=O)c2oc(Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C17H14N2O4/c1-22-17(21)12-8-13(18-10-20)16-14(9-12)19-15(23-16)7-11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3,(H,18,20) |
| InChIKey | YCUJAQRMWBOTED-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|