C19H15N3O4 — CID 168524164
methyl 2-benzyl-7-[(2-cyanoacetyl)amino]-1,3-benzoxazole-5-carboxylate (PubChem CID 168524164) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is methyl 2-benzyl-7-[(2-cyanoacetyl)amino]-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-benzyl-7-[(2-cyanoacetyl)amino]-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 168524164 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl 2-benzyl-7-[(2-cyanoacetyl)amino]-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CC#N)c2oc(Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C19H15N3O4/c1-25-19(24)13-10-14(21-16(23)7-8-20)18-15(11-13)22-17(26-18)9-12-5-3-2-4-6-12/h2-6,10-11H,7,9H2,1H3,(H,21,23) |
| InChIKey | HIFUNMMGPYAKHX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |