C24H26N6O3 — CID 169378179
methyl 2-benzyl-7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3-benzoxazole-5-carboxylate (PubChem CID 169378179) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is methyl 2-benzyl-7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-benzyl-7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 169378179 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methyl 2-benzyl-7-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1cc(N2C(N)=NC(N)=NC23CCCCC3)c2oc(Cc3ccccc3)nc2c1 |
| InChI | InChI=1S/C24H26N6O3/c1-32-21(31)16-13-17-20(33-19(27-17)12-15-8-4-2-5-9-15)18(14-16)30-23(26)28-22(25)29-24(30)10-6-3-7-11-24/h2,4-5,8-9,13-14H,3,6-7,10-12H2,1H3,(H4,25,26,28,29) |
| InChIKey | PDAWXBCEFLQSGH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |