C14H17NO3 — CID 91273560
ethane;methyl 2-benzyl-1,3-oxazole-4-carboxylate (PubChem CID 91273560) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethane;methyl 2-benzyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethane;methyl 2-benzyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 91273560 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethane;methyl 2-benzyl-1,3-oxazole-4-carboxylate |
| SMILES | CC.COC(=O)c1coc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H11NO3.C2H6/c1-15-12(14)10-8-16-11(13-10)7-9-5-3-2-4-6-9;1-2/h2-6,8H,7H2,1H3;1-2H3 |
| InChIKey | MFKKSYRIEWKOOE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |