C6H7NO3S — CID 165481835
methyl 2-(sulfanylmethyl)-1,3-oxazole-4-carboxylate (PubChem CID 165481835) has the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. Its IUPAC name is methyl 2-(sulfanylmethyl)-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-(sulfanylmethyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 165481835 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | methyl 2-(sulfanylmethyl)-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CS)n1 |
| InChI | InChI=1S/C6H7NO3S/c1-9-6(8)4-2-10-5(3-11)7-4/h2,11H,3H2,1H3 |
| InChIKey | AIXHOCMSMMDIRN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|