C19H33NO4 — CID 169131542
methyl 2-tetradecoxy-1,3-oxazole-4-carboxylate (PubChem CID 169131542) has the molecular formula C19H33NO4 and a molecular weight of 339.48 g/mol. Its IUPAC name is methyl 2-tetradecoxy-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-tetradecoxy-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 169131542 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | methyl 2-tetradecoxy-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCCCCCCCCCCOc1nc(C(=O)OC)co1 |
| InChI | InChI=1S/C19H33NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-23-19-20-17(16-24-19)18(21)22-2/h16H,3-15H2,1-2H3 |
| InChIKey | KIAXSRZFZSDWLW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|