C12H19NO6 — CID 103401572
ethyl 2-[3-(2-methoxyethoxy)propoxy]-1,3-oxazole-4-carboxylate (PubChem CID 103401572) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is ethyl 2-[3-(2-methoxyethoxy)propoxy]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[3-(2-methoxyethoxy)propoxy]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 103401572 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl 2-[3-(2-methoxyethoxy)propoxy]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(OCCCOCCOC)n1 |
| InChI | InChI=1S/C12H19NO6/c1-3-17-11(14)10-9-19-12(13-10)18-6-4-5-16-8-7-15-2/h9H,3-8H2,1-2H3 |
| InChIKey | CRSMTMGVMZGDFQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|