C14H15NO4 — CID 113376952
ethyl 2-(2,4-dimethylphenoxy)-1,3-oxazole-4-carboxylate (PubChem CID 113376952) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 2-(2,4-dimethylphenoxy)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(2,4-dimethylphenoxy)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 113376952 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl 2-(2,4-dimethylphenoxy)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(Oc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C14H15NO4/c1-4-17-13(16)11-8-18-14(15-11)19-12-6-5-9(2)7-10(12)3/h5-8H,4H2,1-3H3 |
| InChIKey | LPZWJULVJDRNEB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |