C7H9NO5S — CID 151928550
ethyl 2-methylsulfonyl-1,3-oxazole-4-carboxylate (PubChem CID 151928550) has the molecular formula C7H9NO5S and a molecular weight of 219.22 g/mol. Its IUPAC name is ethyl 2-methylsulfonyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-methylsulfonyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 151928550 |
| Molecular Formula | C7H9NO5S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | ethyl 2-methylsulfonyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C7H9NO5S/c1-3-12-6(9)5-4-13-7(8-5)14(2,10)11/h4H,3H2,1-2H3 |
| InChIKey | SYHHIALPJNCTDE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |