C8H10N2O3 — CID 163648530
ethyl 2-(methyliminomethyl)-1,3-oxazole-4-carboxylate (PubChem CID 163648530) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is ethyl 2-(methyliminomethyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(methyliminomethyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 163648530 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | ethyl 2-(methyliminomethyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(/C=N/C)n1 |
| InChI | InChI=1S/C8H10N2O3/c1-3-12-8(11)6-5-13-7(10-6)4-9-2/h4-5H,3H2,1-2H3/b9-4+ |
| InChIKey | IKGSEBASWIVJQX-RUDMXATFSA-N |
| XLogP | 0.90 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|