C10H13NO4 — CID 15128948
ethyl 2-[(E)-2-ethoxyethenyl]-1,3-oxazole-4-carboxylate (PubChem CID 15128948) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 2-[(E)-2-ethoxyethenyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[(E)-2-ethoxyethenyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 15128948 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | ethyl 2-[(E)-2-ethoxyethenyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCO/C=C/c1nc(C(=O)OCC)co1 |
| InChI | InChI=1S/C10H13NO4/c1-3-13-6-5-9-11-8(7-15-9)10(12)14-4-2/h5-7H,3-4H2,1-2H3/b6-5+ |
| InChIKey | CWGLKZLSORDCFM-AATRIKPKSA-N |
| XLogP | 1.86 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|