C10H13NO3 — CID 25215536
ethyl 2-[(E)-but-2-en-2-yl]-1,3-oxazole-4-carboxylate (PubChem CID 25215536) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is ethyl 2-[(E)-but-2-en-2-yl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[(E)-but-2-en-2-yl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 25215536 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | ethyl 2-[(E)-but-2-en-2-yl]-1,3-oxazole-4-carboxylate |
| SMILES | C/C=C(\C)c1nc(C(=O)OCC)co1 |
| InChI | InChI=1S/C10H13NO3/c1-4-7(3)9-11-8(6-14-9)10(12)13-5-2/h4,6H,5H2,1-3H3/b7-4+ |
| InChIKey | SISHEPTXWUOZDN-QPJJXVBHSA-N |
| XLogP | 2.27 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |