C10H16N2O4 — CID 44516087
ethyl 2-[(2-methoxyethylamino)methyl]-1,3-oxazole-4-carboxylate (PubChem CID 44516087) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is ethyl 2-[(2-methoxyethylamino)methyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[(2-methoxyethylamino)methyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 44516087 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | ethyl 2-[(2-methoxyethylamino)methyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(CNCCOC)n1 |
| InChI | InChI=1S/C10H16N2O4/c1-3-15-10(13)8-7-16-9(12-8)6-11-4-5-14-2/h7,11H,3-6H2,1-2H3 |
| InChIKey | NCNBCTMNYZUFJA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|