About 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide
2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3858413) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 3858413 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCNC(=O)c1coc(CCN)n1 |
| InChI | InChI=1S/C9H15N3O3/c1-14-5-4-11-9(13)7-6-15-8(12-7)2-3-10/h6H,2-5,10H2,1H3,(H,11,13) |
| InChIKey | LQQOGSGBDAOMSQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide (CID 3858413) is 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide is COCCNC(=O)c1coc(CCN)n1.
What is the InChIKey of 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is LQQOGSGBDAOMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-14-5-4-11-9(13)7-6-15-8(12-7)2-3-10/h6H,2-5,10H2,1H3,(H,11,13).
What are the key properties of 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide?
2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 213.24 g/mol, XLogP of -0.45, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 3858413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).