C18H23ClN4O3 — CID 42850946
2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide (PubChem CID 42850946) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42850946 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCNC(=O)c1coc(CN2CCN(c3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C18H23ClN4O3/c1-25-10-5-20-18(24)16-13-26-17(21-16)12-22-6-8-23(9-7-22)15-4-2-3-14(19)11-15/h2-4,11,13H,5-10,12H2,1H3,(H,20,24) |
| InChIKey | LDNDGOIEDKNHLU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|