C23H33N5O3 — CID 42858740
2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-piperidin-1-ylethyl)-1,3-oxazole-4-carboxamide (PubChem CID 42858740) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-piperidin-1-ylethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-piperidin-1-ylethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42858740 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 2-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-N-(2-piperidin-1-ylethyl)-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(N2CCN(Cc3nc(C(=O)NCCN4CCCCC4)co3)CC2)cc1 |
| InChI | InChI=1S/C23H33N5O3/c1-30-20-7-5-19(6-8-20)28-15-13-27(14-16-28)17-22-25-21(18-31-22)23(29)24-9-12-26-10-3-2-4-11-26/h5-8,18H,2-4,9-17H2,1H3,(H,24,29) |
| InChIKey | QGYLOACCZRNVOJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|