C26H34N6O3 — CID 20925175
N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-6-methyl-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide (PubChem CID 20925175) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-6-methyl-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-6-methyl-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 20925175 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-6-methyl-4-piperidin-1-ylfuro[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(N2CCN(CCNC(=O)c3c(C)oc4ncnc(N5CCCCC5)c34)CC2)cc1 |
| InChI | InChI=1S/C26H34N6O3/c1-19-22(23-24(28-18-29-26(23)35-19)32-11-4-3-5-12-32)25(33)27-10-13-30-14-16-31(17-15-30)20-6-8-21(34-2)9-7-20/h6-9,18H,3-5,10-17H2,1-2H3,(H,27,33) |
| InChIKey | ZGNGHCZOGDGSDQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|