C12H11BrN2O4 — CID 103589113
ethyl 2-(3-amino-5-bromophenoxy)-1,3-oxazole-4-carboxylate (PubChem CID 103589113) has the molecular formula C12H11BrN2O4 and a molecular weight of 327.13 g/mol. Its IUPAC name is ethyl 2-(3-amino-5-bromophenoxy)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(3-amino-5-bromophenoxy)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 103589113 |
| Molecular Formula | C12H11BrN2O4 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | ethyl 2-(3-amino-5-bromophenoxy)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(Oc2cc(N)cc(Br)c2)n1 |
| InChI | InChI=1S/C12H11BrN2O4/c1-2-17-11(16)10-6-18-12(15-10)19-9-4-7(13)3-8(14)5-9/h3-6H,2,14H2,1H3 |
| InChIKey | SDRIAZYBHVJOEF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|