C16H14N4O4 — CID 58917188
ethyl 2-[4-(3-aminophenoxy)pyrimidin-2-yl]-1,3-oxazole-4-carboxylate (PubChem CID 58917188) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is ethyl 2-[4-(3-aminophenoxy)pyrimidin-2-yl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[4-(3-aminophenoxy)pyrimidin-2-yl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 58917188 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | ethyl 2-[4-(3-aminophenoxy)pyrimidin-2-yl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2nccc(Oc3cccc(N)c3)n2)n1 |
| InChI | InChI=1S/C16H14N4O4/c1-2-22-16(21)12-9-23-15(19-12)14-18-7-6-13(20-14)24-11-5-3-4-10(17)8-11/h3-9H,2,17H2,1H3 |
| InChIKey | TWHJKQZIKMUNCV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|