C15H19N3O5 — CID 118636201
ethyl 2-[2-[2-(2-aminoethoxy)ethoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylate (PubChem CID 118636201) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is ethyl 2-[2-[2-(2-aminoethoxy)ethoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[2-[2-(2-aminoethoxy)ethoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 118636201 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | ethyl 2-[2-[2-(2-aminoethoxy)ethoxy]-4-pyridinyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccnc(OCCOCCN)c2)n1 |
| InChI | InChI=1S/C15H19N3O5/c1-2-21-15(19)12-10-23-14(18-12)11-3-5-17-13(9-11)22-8-7-20-6-4-16/h3,5,9-10H,2,4,6-8,16H2,1H3 |
| InChIKey | CQQFUOYLLWVEGI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|