C19H25NO5 — CID 118336683
ethyl 2-(4-butoxy-3-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 118336683) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl 2-(4-butoxy-3-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-(4-butoxy-3-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 118336683 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | ethyl 2-(4-butoxy-3-propan-2-yloxyphenyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCCCOc1ccc(-c2nc(C(=O)OCC)co2)cc1OC(C)C |
| InChI | InChI=1S/C19H25NO5/c1-5-7-10-23-16-9-8-14(11-17(16)25-13(3)4)18-20-15(12-24-18)19(21)22-6-2/h8-9,11-13H,5-7,10H2,1-4H3 |
| InChIKey | KJSHKRDMMAKXGO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|