C18H24N2O5 — CID 67963632
methyl 2-(4,5-dibutoxy-2-pyridinyl)-1,3-oxazole-4-carboxylate (PubChem CID 67963632) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 2-(4,5-dibutoxy-2-pyridinyl)-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-(4,5-dibutoxy-2-pyridinyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 67963632 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 2-(4,5-dibutoxy-2-pyridinyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCCCOc1cnc(-c2nc(C(=O)OC)co2)cc1OCCCC |
| InChI | InChI=1S/C18H24N2O5/c1-4-6-8-23-15-10-13(19-11-16(15)24-9-7-5-2)17-20-14(12-25-17)18(21)22-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | RSMVBGGKLAIQLW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|