C17H22N2O6 — CID 67963629
2-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 67963629) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67963629 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-(4,5-dibutoxy-1-oxidopyridin-1-ium-2-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | CCCCOc1cc(-c2nc(C(=O)O)co2)[n+]([O-])cc1OCCCC |
| InChI | InChI=1S/C17H22N2O6/c1-3-5-7-23-14-9-13(16-18-12(11-25-16)17(20)21)19(22)10-15(14)24-8-6-4-2/h9-11H,3-8H2,1-2H3,(H,20,21) |
| InChIKey | LSODBVDOHWTIGF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|