C23H19N2O6+ — CID 140617274
2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 140617274) has the molecular formula C23H19N2O6+ and a molecular weight of 419.41 g/mol. Its IUPAC name is 2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 140617274 |
| Molecular Formula | C23H19N2O6+ |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(-c2cc(OCc3ccccc3)c(OCc3ccccc3)c[n+]2O)n1 |
| InChI | InChI=1S/C23H18N2O6/c26-23(27)18-15-31-22(24-18)19-11-20(29-13-16-7-3-1-4-8-16)21(12-25(19)28)30-14-17-9-5-2-6-10-17/h1-12,15H,13-14H2,(H-,24,26,27,28)/p+1 |
| InChIKey | VGTAGARINLWZDG-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|