C22H22NO6+ — CID 139364643
methyl 2-hydroxy-2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]acetate (PubChem CID 139364643) has the molecular formula C22H22NO6+ and a molecular weight of 396.42 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]acetate.
| Compound Name | methyl 2-hydroxy-2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]acetate |
|---|---|
| PubChem CID | 139364643 |
| Molecular Formula | C22H22NO6+ |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 2-hydroxy-2-[1-hydroxy-4,5-bis(phenylmethoxy)pyridin-1-ium-2-yl]acetate |
| SMILES | COC(=O)C(O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c[n+]1O |
| InChI | InChI=1S/C22H22NO6/c1-27-22(25)21(24)18-12-19(28-14-16-8-4-2-5-9-16)20(13-23(18)26)29-15-17-10-6-3-7-11-17/h2-13,21,24,26H,14-15H2,1H3/q+1 |
| InChIKey | AKGKJIIHEZHOIP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|