C25H30NO6+ — CID 134198011
1-[1-hydroxy-4,5-bis[(4-methoxyphenyl)methoxy]pyridin-1-ium-2-yl]-2-methylpropan-1-ol (PubChem CID 134198011) has the molecular formula C25H30NO6+ and a molecular weight of 440.52 g/mol. Its IUPAC name is 1-[1-hydroxy-4,5-bis[(4-methoxyphenyl)methoxy]pyridin-1-ium-2-yl]-2-methylpropan-1-ol.
| Compound Name | 1-[1-hydroxy-4,5-bis[(4-methoxyphenyl)methoxy]pyridin-1-ium-2-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 134198011 |
| Molecular Formula | C25H30NO6+ |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[1-hydroxy-4,5-bis[(4-methoxyphenyl)methoxy]pyridin-1-ium-2-yl]-2-methylpropan-1-ol |
| SMILES | COc1ccc(COc2cc(C(O)C(C)C)[n+](O)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H30NO6/c1-17(2)25(27)22-13-23(31-15-18-5-9-20(29-3)10-6-18)24(14-26(22)28)32-16-19-7-11-21(30-4)12-8-19/h5-14,17,25,27-28H,15-16H2,1-4H3/q+1 |
| InChIKey | DYVNWWZLZDNPKA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|