C25H29NO5 — CID 134197964
1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-methylpropan-1-ol (PubChem CID 134197964) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-methylpropan-1-ol.
| Compound Name | 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 134197964 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-2-methylpropan-1-ol |
| SMILES | COc1ccc(COc2cnc(C(O)C(C)C)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H29NO5/c1-17(2)25(27)22-13-23(30-15-18-5-9-20(28-3)10-6-18)24(14-26-22)31-16-19-7-11-21(29-4)12-8-19/h5-14,17,25,27H,15-16H2,1-4H3 |
| InChIKey | HKHOYMUPDBPAEF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |