C33H37N3O9 — CID 175055151
4-[[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]methoxy]-N-[(2S,3R)-1,3-dihydroxy-1-(hydroxyamino)butan-2-yl]benzamide (PubChem CID 175055151) has the molecular formula C33H37N3O9 and a molecular weight of 619.67 g/mol. Its IUPAC name is 4-[[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]methoxy]-N-[(2S,3R)-1,3-dihydroxy-1-(hydroxyamino)butan-2-yl]benzamide.
| Compound Name | 4-[[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]methoxy]-N-[(2S,3R)-1,3-dihydroxy-1-(hydroxyamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 175055151 |
| Molecular Formula | C33H37N3O9 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 4-[[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]methoxy]-N-[(2S,3R)-1,3-dihydroxy-1-(hydroxyamino)butan-2-yl]benzamide |
| SMILES | COc1ccc(COc2cnc(COc3ccc(C(=O)N[C@H](C(O)NO)[C@@H](C)O)cc3)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H37N3O9/c1-21(37)31(33(39)36-40)35-32(38)24-8-14-28(15-9-24)43-20-25-16-29(44-18-22-4-10-26(41-2)11-5-22)30(17-34-25)45-19-23-6-12-27(42-3)13-7-23/h4-17,21,31,33,36-37,39-40H,18-20H2,1-3H3,(H,35,38)/t21-,31+,33?/m1/s1 |
| InChIKey | PSCREQLQRZESRD-YXVFIXGTSA-N |
| XLogP | 3.61 |
| TPSA | 160.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|