C31H27Br2NO6 — CID 161338624
2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetonitrile;methyl 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetate (PubChem CID 161338624) has the molecular formula C31H27Br2NO6 and a molecular weight of 669.37 g/mol. Its IUPAC name is 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetonitrile;methyl 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetate.
| Compound Name | 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetonitrile;methyl 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 161338624 |
| Molecular Formula | C31H27Br2NO6 |
| Molecular Weight | 669.37 g/mol |
| Exact Mass | 667.02 |
| IUPAC Name | 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetonitrile;methyl 2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1cc(Br)ccc1OCc1ccccc1.N#CC(O)c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H15BrO4.C15H12BrNO2/c1-20-16(19)15(18)13-9-12(17)7-8-14(13)21-10-11-5-3-2-4-6-11;16-12-6-7-15(13(8-12)14(18)9-17)19-10-11-4-2-1-3-5-11/h2-9,15,18H,10H2,1H3;1-8,14,18H,10H2 |
| InChIKey | VMJJFZOVMCOBLG-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.37 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|