C16H17BrO3 — CID 156555917
2-(5-bromo-2-phenylmethoxyphenyl)propane-1,3-diol (PubChem CID 156555917) has the molecular formula C16H17BrO3 and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-(5-bromo-2-phenylmethoxyphenyl)propane-1,3-diol.
| Compound Name | 2-(5-bromo-2-phenylmethoxyphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 156555917 |
| Molecular Formula | C16H17BrO3 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-(5-bromo-2-phenylmethoxyphenyl)propane-1,3-diol |
| SMILES | OCC(CO)c1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H17BrO3/c17-14-6-7-16(15(8-14)13(9-18)10-19)20-11-12-4-2-1-3-5-12/h1-8,13,18-19H,9-11H2 |
| InChIKey | MCJJJGOPFDUNNQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |