C20H24BrNO3 — CID 141118408
1-[2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyethyl]piperidin-4-ol (PubChem CID 141118408) has the molecular formula C20H24BrNO3 and a molecular weight of 406.32 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyethyl]piperidin-4-ol.
| Compound Name | 1-[2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyethyl]piperidin-4-ol |
|---|---|
| PubChem CID | 141118408 |
| Molecular Formula | C20H24BrNO3 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-[2-(5-bromo-2-phenylmethoxyphenyl)-2-hydroxyethyl]piperidin-4-ol |
| SMILES | OC1CCN(CC(O)c2cc(Br)ccc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24BrNO3/c21-16-6-7-20(25-14-15-4-2-1-3-5-15)18(12-16)19(24)13-22-10-8-17(23)9-11-22/h1-7,12,17,19,23-24H,8-11,13-14H2 |
| InChIKey | DGPXPWPRSUWAPY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |